CAS 1270583-14-6 is the registry number for 6-(Trifluoromethyl)chroman-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-ol (CAS 1270583-14-6) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-ol. InChIKey: OQQCQRXIAUSFDL-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | OQQCQRXIAUSFDL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1O)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)