CAS 1270614-28-2 appears in our catalog under these names: 2-(2-Chloro-6-fluorophenyl)-2-(N-methylacetamido)acetic acid, 2-(2-Chloro-6-fluorophenyl)-2-(n-methylacetamido)acetic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 250mg, 1g.
2-[acetyl(methyl)amino]-2-(2-chloro-6-fluorophenyl)acetic acid (CAS 1270614-28-2) is a chemical compound with the molecular formula C11H11ClFNO3 and a molecular weight of 259.66 g/mol. IUPAC name: 2-[acetyl(methyl)amino]-2-(2-chloro-6-fluorophenyl)acetic acid. InChIKey: DNDPWFMOXVRLDA-UHFFFAOYSA-N.
| Molecular formula | C11H11ClFNO3 |
|---|---|
| Molecular weight | 259.66 g/mol |
| IUPAC name | 2-[acetyl(methyl)amino]-2-(2-chloro-6-fluorophenyl)acetic acid |
| InChIKey | DNDPWFMOXVRLDA-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C(C1=C(C=CC=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)