Products 127074-04-8
CAS 127074-04-8 is the registry number for Methyl 6,6,6-Trifluoro-5-hydroxy-4-nitrohexanoate. Offered by: TRC. Available pack sizes: 1g.
Methyl 6,6,6-trifluoro-5-hydroxy-4-nitrohexanoate (CAS 127074-04-8) is a chemical compound with the molecular formula C7H10F3NO5 and a molecular weight of 245.15 g/mol. IUPAC name: methyl 6,6,6-trifluoro-5-hydroxy-4-nitrohexanoate. InChIKey: NAMTZBPOMKLYGC-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO5 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | methyl 6,6,6-trifluoro-5-hydroxy-4-nitrohexanoate |
| InChIKey | NAMTZBPOMKLYGC-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(C(C(F)(F)F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)