CAS 1271-47-2 appears in our catalog under these names: Ethynylferrocene (~90%), >95% (HPLC), Ethynylferrocene (>90%), >95% (HPLC), Ethynylferrocene, Ethynylferrocene, >95.0%(GC), Ethynylferrocene, 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100mg, 500mg, 50mg, 1g, 25g, 5g, 10g, 250mg.
Cyclopenta-1,3-diene;2-ethynylcyclopenta-1,3-diene;iron(2+) (CAS 1271-47-2) is a chemical compound with the molecular formula C12H10Fe and a molecular weight of 210.05 g/mol. IUPAC name: cyclopenta-1,3-diene;2-ethynylcyclopenta-1,3-diene;iron(2+). InChIKey: BXSUNBWPHNMDRM-UHFFFAOYSA-N.
| Molecular formula | C12H10Fe |
|---|---|
| Molecular weight | 210.05 g/mol |
| IUPAC name | cyclopenta-1,3-diene;2-ethynylcyclopenta-1,3-diene;iron(2+) |
| InChIKey | BXSUNBWPHNMDRM-UHFFFAOYSA-N |
| SMILES | C#CC1=C[CH-]C=C1.[CH-]1C=CC=C1.[Fe+2] |
Computed by PubChem (NCBI)