Products 1271-54-1
CAS 1271-54-1 appears in our catalog under these names: Chromium, bis(η6-benzene)-, 97%, Bis(benzene)chromium(0) 97 %. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 1g.
Benzene;chromium;cyclohexane (CAS 1271-54-1) is a chemical compound with the molecular formula C12H12Cr-6 and a molecular weight of 208.22 g/mol. IUPAC name: benzene;chromium;cyclohexane. InChIKey: IWCQVOVBDXJJDF-UHFFFAOYSA-N.
| Molecular formula | C12H12Cr-6 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | benzene;chromium;cyclohexane |
| InChIKey | IWCQVOVBDXJJDF-UHFFFAOYSA-N |
| SMILES | [CH-]1[CH-][CH-][CH-][CH-][CH-]1.C1=CC=CC=C1.[Cr] |
Computed by PubChem (NCBI)
Synonyms:
Dibenzenechromium, Chromium, bis(benzene)-, Bis(benzene)chromium, Chromium(II), diphenyl-, Bis(eta(sup 6)-benzene)chromium, Chromium, bis(eta(sup 6)-benzene)-, Chromium, bis(eta(sup 6)-benzene)-(9CI), benzene cyclohexane-1,2,3,4,5,6-hexaide chromium, Chromium, bis(benzene)-(8CI), Diphenylchromium