Products 127199-38-6
CAS 127199-38-6 is the registry number for (7S)-7-amino-5-[(1R)-1-phenylethyl]-5-azaspiro[2.4]heptan-4-one, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(7S)-7-amino-5-[(1R)-1-phenylethyl]-5-azaspiro[2.4]heptan-4-one (CAS 127199-38-6) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (7S)-7-amino-5-[(1R)-1-phenylethyl]-5-azaspiro[2.4]heptan-4-one. InChIKey: PVVUAPNCOAUUJL-ZYHUDNBSSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (7S)-7-amino-5-[(1R)-1-phenylethyl]-5-azaspiro[2.4]heptan-4-one |
| InChIKey | PVVUAPNCOAUUJL-ZYHUDNBSSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2C[C@H](C3(C2=O)CC3)N |
Computed by PubChem (NCBI)