CAS 1272031-55-6 appears in our catalog under these names: (R)-2-Methyl-2-phenylpiperidine, 97%, (R)–2–Methyl–2–phenylpiperidine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 500mg.
(2R)-2-methyl-2-phenylpiperidine (CAS 1272031-55-6) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (2R)-2-methyl-2-phenylpiperidine. InChIKey: FLNODMVWOCAIEF-GFCCVEGCSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2R)-2-methyl-2-phenylpiperidine |
| InChIKey | FLNODMVWOCAIEF-GFCCVEGCSA-N |
| SMILES | C[C@@]1(CCCCN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)