CAS 1272100-79-4 is the registry number for 1-(2-Bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanol (CAS 1272100-79-4) is a chemical compound with the molecular formula C10H10BrF3O3 and a molecular weight of 315.08 g/mol. IUPAC name: 1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: NWFAVNWQIGDZSJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O3 |
|---|---|
| Molecular weight | 315.08 g/mol |
| IUPAC name | 1-(2-bromo-4,5-dimethoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | NWFAVNWQIGDZSJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(C(F)(F)F)O)Br)OC |
Computed by PubChem (NCBI)