CAS 1272120-70-3 is the registry number for 3-(2-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1272120-70-3) is a chemical compound with the molecular formula C13H8FN3O2 and a molecular weight of 257.22 g/mol. IUPAC name: 3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: ZIURGGVQRXCRCH-UHFFFAOYSA-N.
| Molecular formula | C13H8FN3O2 |
|---|---|
| Molecular weight | 257.22 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | ZIURGGVQRXCRCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C3N2C=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)