Products 127223-95-4
CAS 127223-95-4 is the registry number for 1,1,1-Trifluoro-4-(isopropylamino)pent-3-en-2-one, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1,1,1-trifluoro-4-(propan-2-ylamino)pent-3-en-2-one (CAS 127223-95-4) is a chemical compound with the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. IUPAC name: 1,1,1-trifluoro-4-(propan-2-ylamino)pent-3-en-2-one. InChIKey: BKNFRFGKUBBQME-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 1,1,1-trifluoro-4-(propan-2-ylamino)pent-3-en-2-one |
| InChIKey | BKNFRFGKUBBQME-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=CC(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)