Products 1272755-17-5
CAS 1272755-17-5 is the registry number for Dde-l-alaninol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]ethylidene]-5,5-dimethylcyclohexane-1,3-dione (CAS 1272755-17-5) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: 2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]ethylidene]-5,5-dimethylcyclohexane-1,3-dione. InChIKey: SRUOCPIKCYVMTG-VIFPVBQESA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]ethylidene]-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | SRUOCPIKCYVMTG-VIFPVBQESA-N |
| SMILES | C[C@@H](CO)NCC=C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)