CAS 1272756-12-3 appears in our catalog under these names: 2-(Carboxymethoxy)-4-fluorobenzoic acid, 95%, 2–(Carboxymethoxy)–4–fluorobenzoic Acid, 2-(Carboxymethoxy)-4-fluorobenzoic Acid, >97%, >97%, 2-(Carboxymethoxy)-4-fluorobenzoic acid, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(carboxymethoxy)-4-fluorobenzoic acid (CAS 1272756-12-3) is a chemical compound with the molecular formula C9H7FO5 and a molecular weight of 214.15 g/mol. IUPAC name: 2-(carboxymethoxy)-4-fluorobenzoic acid. InChIKey: ZPFRPPABXMLDLB-UHFFFAOYSA-N.
| Molecular formula | C9H7FO5 |
|---|---|
| Molecular weight | 214.15 g/mol |
| IUPAC name | 2-(carboxymethoxy)-4-fluorobenzoic acid |
| InChIKey | ZPFRPPABXMLDLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)