Products 1272927-57-7
CAS 1272927-57-7 is the registry number for 4-Bromo-N,N-bis(2-methylpropyl)-2-nitroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-N,N-bis(2-methylpropyl)-2-nitroaniline (CAS 1272927-57-7) is a chemical compound with the molecular formula C14H21BrN2O2 and a molecular weight of 329.23 g/mol. IUPAC name: 4-bromo-N,N-bis(2-methylpropyl)-2-nitroaniline. InChIKey: KALFOVPLZHMDEC-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O2 |
|---|---|
| Molecular weight | 329.23 g/mol |
| IUPAC name | 4-bromo-N,N-bis(2-methylpropyl)-2-nitroaniline |
| InChIKey | KALFOVPLZHMDEC-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)