CAS 127294-70-6 appears in our catalog under these names: Balofloxacin, Balofloxacin/ 99.84% (existing batch purity), Balofloxacin, 98%, 98%, Balofloxacin (Standard), Balofloxacin, 98.26%. Offered by: Chemat Brand, Dr. Ehrenstorfer, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 25mg, 1g, 100mg, 200mg, 500mg, 5g, 2g.
1-cyclopropyl-6-fluoro-8-methoxy-7-[3-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid (CAS 127294-70-6) is a chemical compound with the molecular formula C20H24FN3O4 and a molecular weight of 389.4 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-8-methoxy-7-[3-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid. InChIKey: MGQLHRYJBWGORO-UHFFFAOYSA-N.
| Molecular formula | C20H24FN3O4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[3-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| InChIKey | MGQLHRYJBWGORO-UHFFFAOYSA-N |
| SMILES | CNC1CCCN(C1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F |
Computed by PubChem (NCBI)