CAS 127296-24-6 is the registry number for Indoxacarb Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(Z)-3-(2-chlorophenyl)-2-(4-fluorophenyl)prop-2-enyl]-1,2,4-triazole (CAS 127296-24-6) is a chemical compound with the molecular formula C17H13ClFN3 and a molecular weight of 313.8 g/mol. IUPAC name: 1-[(Z)-3-(2-chlorophenyl)-2-(4-fluorophenyl)prop-2-enyl]-1,2,4-triazole. InChIKey: OMUJJDNUQGWFAT-OQLLNIDSSA-N.
| Molecular formula | C17H13ClFN3 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 1-[(Z)-3-(2-chlorophenyl)-2-(4-fluorophenyl)prop-2-enyl]-1,2,4-triazole |
| InChIKey | OMUJJDNUQGWFAT-OQLLNIDSSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C(\CN2C=NC=N2)/C3=CC=C(C=C3)F)Cl |
Computed by PubChem (NCBI)