CAS 1273-82-1 appears in our catalog under these names: Aminoferrocene, 97%, Aminoferrocene, Aminoferrocene, >96.0%(GC)(T), Aminoferrocene 97%, Aminoferrocene, 97%, 97%. Offered by: Fluorochem, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg.
Cyclopenta-1,4-dien-1-amine;cyclopenta-1,3-diene;iron(2+) (CAS 1273-82-1) is a chemical compound with the molecular formula C10H11FeN and a molecular weight of 201.05 g/mol. IUPAC name: cyclopenta-1,4-dien-1-amine;cyclopenta-1,3-diene;iron(2+). InChIKey: MYCZBBOLTYBTCX-UHFFFAOYSA-N.
| Molecular formula | C10H11FeN |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | cyclopenta-1,4-dien-1-amine;cyclopenta-1,3-diene;iron(2+) |
| InChIKey | MYCZBBOLTYBTCX-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC(=C1)N.[Fe+2] |
Computed by PubChem (NCBI)