CAS 1273-85-4 is the registry number for Ferrocenecarbonyl Azide. Offered by: TRC. Available pack sizes: 100mg.
Azido(cyclopenta-2,4-dien-1-ylidene)methanolate;cyclopenta-1,3-diene;iron(2+) (CAS 1273-85-4) is a chemical compound with the molecular formula C11H9FeN3O and a molecular weight of 255.05 g/mol. IUPAC name: azido(cyclopenta-2,4-dien-1-ylidene)methanolate;cyclopenta-1,3-diene;iron(2+). InChIKey: VANNIYPCVFIOTD-UHFFFAOYSA-M.
| Molecular formula | C11H9FeN3O |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | azido(cyclopenta-2,4-dien-1-ylidene)methanolate;cyclopenta-1,3-diene;iron(2+) |
| InChIKey | VANNIYPCVFIOTD-UHFFFAOYSA-M |
| SMILES | [CH-]1C=CC=C1.C1=CC(=C(N=[N+]=[N-])[O-])C=C1.[Fe+2] |
Computed by PubChem (NCBI)