CAS 1273-94-5 appears in our catalog under these names: 1,1'-Diacetylferrocene, 97%, 1,1′–Diacetylferrocene, 1,1'-Diacetylferrocene, 1,1'-Diacetylferrocene, 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Fluorochem. Available pack sizes: on request, 100g, 25g, 10g, 5g.
1-cyclopenta-2,4-dien-1-ylethanone;1-cyclopentylethanone;iron (CAS 1273-94-5) is a chemical compound with the molecular formula C14H14FeO2-6 and a molecular weight of 270.10 g/mol. IUPAC name: 1-cyclopenta-2,4-dien-1-ylethanone;1-cyclopentylethanone;iron. InChIKey: DAVCBKPWWUUYNL-UHFFFAOYSA-N.
| Molecular formula | C14H14FeO2-6 |
|---|---|
| Molecular weight | 270.10 g/mol |
| IUPAC name | 1-cyclopenta-2,4-dien-1-ylethanone;1-cyclopentylethanone;iron |
| InChIKey | DAVCBKPWWUUYNL-UHFFFAOYSA-N |
| SMILES | CC(=O)[C-]1[CH-][CH-][CH-][CH-]1.CC(=O)[C-]1C=CC=C1.[Fe] |
Computed by PubChem (NCBI)