CAS 1273-97-8 appears in our catalog under these names: 1,1'-Diethyl Ferrocene, 97%, 1,1'-Diethylferrocene, 95%, 1,1′–Diethylferrocene. Offered by: Chemat Brand, Combi-blocks, GLPBio. Available pack sizes: on request, 5g, 1g, 10g, 25g.
Bis(1-ethylcyclopenta-1,3-diene);iron(2+) (CAS 1273-97-8) is a chemical compound with the molecular formula C14H18Fe and a molecular weight of 242.14 g/mol. IUPAC name: bis(1-ethylcyclopenta-1,3-diene);iron(2+). InChIKey: CJCVWCLJWGEOOG-UHFFFAOYSA-N.
| Molecular formula | C14H18Fe |
|---|---|
| Molecular weight | 242.14 g/mol |
| IUPAC name | bis(1-ethylcyclopenta-1,3-diene);iron(2+) |
| InChIKey | CJCVWCLJWGEOOG-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C[CH-]1.CCC1=CC=C[CH-]1.[Fe+2] |
Computed by PubChem (NCBI)