CAS 127327-09-7 is the registry number for 1-(1,2-Dimethyl-4-phenyl-1H-pyrrol-3-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,2-dimethyl-4-phenylpyrrol-3-yl)ethanone (CAS 127327-09-7) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 1-(1,2-dimethyl-4-phenylpyrrol-3-yl)ethanone. InChIKey: IGEAZNQQLPADCJ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 1-(1,2-dimethyl-4-phenylpyrrol-3-yl)ethanone |
| InChIKey | IGEAZNQQLPADCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CN1C)C2=CC=CC=C2)C(=O)C |
Computed by PubChem (NCBI)