CAS 1273323-67-3 appears in our catalog under these names: 3-(((3E)-3-((4-Chlorophenyl)phenylmethylene)-2,3-dihydro-2-oxo-1H-indol-1-yl)methyl)benzoic Acid, YLF-466D/ 98.04% (existing batch purity), YLF–466D, YLF-466D, YLF-466D, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid (CAS 1273323-67-3) is a chemical compound with the molecular formula C29H20ClNO3 and a molecular weight of 465.9 g/mol. IUPAC name: 3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid. InChIKey: BPBOVHROVFJFAH-CYYJNZCTSA-N.
| Molecular formula | C29H20ClNO3 |
|---|---|
| Molecular weight | 465.9 g/mol |
| IUPAC name | 3-[[(3E)-3-[(4-chlorophenyl)-phenylmethylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
| InChIKey | BPBOVHROVFJFAH-CYYJNZCTSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\2/C3=CC=CC=C3N(C2=O)CC4=CC(=CC=C4)C(=O)O)/C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)