Products 1273595-77-9
CAS 1273595-77-9 appears in our catalog under these names: 4-FLUORO-5-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE, 97%, 4-FLUORO-5-METHYL-INDAN-1-ONE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-fluoro-5-methyl-2,3-dihydroinden-1-one (CAS 1273595-77-9) is a chemical compound with the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. IUPAC name: 4-fluoro-5-methyl-2,3-dihydroinden-1-one. InChIKey: DTMFFJVAEGTLHX-UHFFFAOYSA-N.
| Molecular formula | C10H9FO |
|---|---|
| Molecular weight | 164.18 g/mol |
| IUPAC name | 4-fluoro-5-methyl-2,3-dihydroinden-1-one |
| InChIKey | DTMFFJVAEGTLHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)CC2)F |
Computed by PubChem (NCBI)