CAS 1273662-90-0 is the registry number for 8-Bromo-6-chloro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-chloro-3,4-dihydro-2H-naphthalen-1-one (CAS 1273662-90-0) is a chemical compound with the molecular formula C10H8BrClO and a molecular weight of 259.52 g/mol. IUPAC name: 8-bromo-6-chloro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: CTIRVWZTUHLQRB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClO |
|---|---|
| Molecular weight | 259.52 g/mol |
| IUPAC name | 8-bromo-6-chloro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | CTIRVWZTUHLQRB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)