CAS 1273673-55-4 is the registry number for 6-Fluoro-5-hydroxy-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-5-hydroxy-2,3-dihydroinden-1-one (CAS 1273673-55-4) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 6-fluoro-5-hydroxy-2,3-dihydroinden-1-one. InChIKey: SLYMXQQHTQPXKD-UHFFFAOYSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 6-fluoro-5-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | SLYMXQQHTQPXKD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)O)F |
Computed by PubChem (NCBI)