Products 1273682-77-1
CAS 1273682-77-1 is the registry number for Ethyl 5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1273682-77-1) is a chemical compound with the molecular formula C12H12ClN3O3 and a molecular weight of 281.69 g/mol. IUPAC name: ethyl 3-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: SYGVZNAGPCPFOW-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O3 |
|---|---|
| Molecular weight | 281.69 g/mol |
| IUPAC name | ethyl 3-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | SYGVZNAGPCPFOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=C(C=CC(=C2)Cl)OC |
Computed by PubChem (NCBI)