CAS 127370-77-8 appears in our catalog under these names: Boc-Leu-(?)-Leu-OH, Boc–Leu–psi(CH₂NH)Leu–OH, Boc-Leu-psi(CH2NH)Leu-OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg.
(2S)-4-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]pentanoic acid (CAS 127370-77-8) is a chemical compound with the molecular formula C17H34N2O4 and a molecular weight of 330.5 g/mol. IUPAC name: (2S)-4-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]pentanoic acid. InChIKey: XWGKJRVDWFEBEO-KBPBESRZSA-N.
| Molecular formula | C17H34N2O4 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]pentanoic acid |
| InChIKey | XWGKJRVDWFEBEO-KBPBESRZSA-N |
| SMILES | CC(C)C[C@@H](CN[C@@H](CC(C)C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)