Products 12738-95-3
CAS 12738-95-3 is the registry number for Tunaxanthin. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tunaxanthin is a carotenol isolated from the white tuna, or albacore tuna (Thunnus albacares). It has a role as an animal metabolite and a marine metabolite.
Source: ChEBI
| Molecular formula | C40H56O2 |
|---|---|
| Molecular weight | 568.9 g/mol |
| IUPAC name | 4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-(4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-2-en-1-ol |
| InChIKey | BIPAHAFBQLWRMC-DKLMTRRASA-N |
| SMILES | CC1=CC(CC(C1/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2C(CC(C=C2C)O)(C)C)\C)\C)/C)/C)(C)C)O |
Computed by PubChem (NCBI)