CAS 1274139-48-8 appears in our catalog under these names: 3-Fluoro-4-(4H-1,2,4-triazol-4-ylmethyl)benzonitrile, 95%, 3-Fluoro-4-(4H-1,2,4-triazol-4-ylmethyl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-fluoro-4-(1,2,4-triazol-4-ylmethyl)benzonitrile (CAS 1274139-48-8) is a chemical compound with the molecular formula C10H7FN4 and a molecular weight of 202.19 g/mol. IUPAC name: 3-fluoro-4-(1,2,4-triazol-4-ylmethyl)benzonitrile. InChIKey: PBYWZCYUNMWYCR-UHFFFAOYSA-N.
| Molecular formula | C10H7FN4 |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 3-fluoro-4-(1,2,4-triazol-4-ylmethyl)benzonitrile |
| InChIKey | PBYWZCYUNMWYCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)F)CN2C=NN=C2 |
Computed by PubChem (NCBI)