CAS 127426-27-1 is the registry number for Dichloro-1,3-thiazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,5-dichloro-1,3-thiazole-4-carboxamide (CAS 127426-27-1) is a chemical compound with the molecular formula C4H2Cl2N2OS and a molecular weight of 197.04 g/mol. IUPAC name: 2,5-dichloro-1,3-thiazole-4-carboxamide. InChIKey: DUQQBKHXRIXAME-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2N2OS |
|---|---|
| Molecular weight | 197.04 g/mol |
| IUPAC name | 2,5-dichloro-1,3-thiazole-4-carboxamide |
| InChIKey | DUQQBKHXRIXAME-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)