CAS 127427-04-7 appears in our catalog under these names: 3,4,5-Trimethoxycinnamic acid sodium salt, 95%, Sodium 3,4,5–Trimethoxycinnamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 1g, 5g.
Sodium (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CAS 127427-04-7) is a chemical compound with the molecular formula C12H13NaO5 and a molecular weight of 260.22 g/mol. IUPAC name: sodium (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate. InChIKey: CNDQKFLPUDASFN-FXRZFVDSSA-M.
| Molecular formula | C12H13NaO5 |
|---|---|
| Molecular weight | 260.22 g/mol |
| IUPAC name | sodium (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| InChIKey | CNDQKFLPUDASFN-FXRZFVDSSA-M |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)