CAS 1274903-92-2 is the registry number for (3-chloro-5-(trifluoromethyl)(2-pyridyl))thiocarboxamidine, hydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg.
[3-chloro-5-(trifluoromethyl)-2-pyridinyl] carbamimidothioate;hydrochloride (CAS 1274903-92-2) is a chemical compound with the molecular formula C7H6Cl2F3N3S and a molecular weight of 292.11 g/mol. IUPAC name: [3-chloro-5-(trifluoromethyl)-2-pyridinyl] carbamimidothioate;hydrochloride. InChIKey: RGTZBZNFUMIFHI-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2F3N3S |
|---|---|
| Molecular weight | 292.11 g/mol |
| IUPAC name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl] carbamimidothioate;hydrochloride |
| InChIKey | RGTZBZNFUMIFHI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)SC(=N)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)