CAS 1274948-22-9 is the registry number for 2,3-diaza-4-(2-furyl)-1-prop-2-ynylthiobuta-1,3-dienylamine, hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg.
Prop-2-ynyl N'-[(E)-furan-2-ylmethylideneamino]carbamimidothioate;hydrochloride (CAS 1274948-22-9) is a chemical compound with the molecular formula C9H10ClN3OS and a molecular weight of 243.71 g/mol. IUPAC name: prop-2-ynyl N'-[(E)-furan-2-ylmethylideneamino]carbamimidothioate;hydrochloride. InChIKey: IUVVORSVHFXTGG-RVDQCCQOSA-N.
| Molecular formula | C9H10ClN3OS |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | prop-2-ynyl N'-[(E)-furan-2-ylmethylideneamino]carbamimidothioate;hydrochloride |
| InChIKey | IUVVORSVHFXTGG-RVDQCCQOSA-N |
| SMILES | C#CCS/C(=N/N=C/C1=CC=CO1)/N.Cl |
Computed by PubChem (NCBI)