Products 127525-07-9

CAS 127525-07-9 is the registry number for Lubiprostone Impurity 5. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

7-[(1R,2R,3R)-2-(4-fluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid (CAS 127525-07-9) is a chemical compound with the molecular formula C20H33FO5 and a molecular weight of 372.5 g/mol. IUPAC name: 7-[(1R,2R,3R)-2-(4-fluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid. InChIKey: DDFPUFVLSZKDBQ-BWCXNJGASA-N.

Identity
Molecular formulaC20H33FO5
Molecular weight372.5 g/mol
IUPAC name7-[(1R,2R,3R)-2-(4-fluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid
InChIKeyDDFPUFVLSZKDBQ-BWCXNJGASA-N
SMILESCCCCC(C(=O)CC[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)F

Computed by PubChem (NCBI)