Products 127553-83-7
CAS 127553-83-7 is the registry number for 2-(2-chloro-4-fluoro-5-nitrophenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-chloro-4-fluoro-5-nitrophenyl)-1,3-dioxolane (CAS 127553-83-7) is a chemical compound with the molecular formula C9H7ClFNO4 and a molecular weight of 247.61 g/mol. IUPAC name: 2-(2-chloro-4-fluoro-5-nitrophenyl)-1,3-dioxolane. InChIKey: GUWIHJAANXBGMY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFNO4 |
|---|---|
| Molecular weight | 247.61 g/mol |
| IUPAC name | 2-(2-chloro-4-fluoro-5-nitrophenyl)-1,3-dioxolane |
| InChIKey | GUWIHJAANXBGMY-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)