CAS 1275545-13-5 is the registry number for ethyl 6,8-dibromo-4-chloroquinoline-3-carboxylate. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 6,8-dibromo-4-chloroquinoline-3-carboxylate (CAS 1275545-13-5) is a chemical compound with the molecular formula C12H8Br2ClNO2 and a molecular weight of 393.46 g/mol. IUPAC name: ethyl 6,8-dibromo-4-chloroquinoline-3-carboxylate. InChIKey: LWSQWKWOGDFWDY-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2ClNO2 |
|---|---|
| Molecular weight | 393.46 g/mol |
| IUPAC name | ethyl 6,8-dibromo-4-chloroquinoline-3-carboxylate |
| InChIKey | LWSQWKWOGDFWDY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)Br)Br |
Computed by PubChem (NCBI)