CAS 1275548-74-7 appears in our catalog under these names: 1-(Bromomethyl)-5-methoxy-4-(2-methylbutoxy)-2-nitrobenzene, 95%, 1-(Bromomethyl)-5-methoxy-4-(2-methylbutoxy)-2-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(bromomethyl)-5-methoxy-4-(2-methylbutoxy)-2-nitrobenzene (CAS 1275548-74-7) is a chemical compound with the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. IUPAC name: 1-(bromomethyl)-5-methoxy-4-(2-methylbutoxy)-2-nitrobenzene. InChIKey: AFWIKLLYPFNHPH-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO4 |
|---|---|
| Molecular weight | 332.19 g/mol |
| IUPAC name | 1-(bromomethyl)-5-methoxy-4-(2-methylbutoxy)-2-nitrobenzene |
| InChIKey | AFWIKLLYPFNHPH-UHFFFAOYSA-N |
| SMILES | CCC(C)COC1=C(C=C(C(=C1)[N+](=O)[O-])CBr)OC |
Computed by PubChem (NCBI)