CAS 1275853-51-4 appears in our catalog under these names: 4-(3-Bromophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine, 95%, 4-(3-Bromophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(3-bromophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine (CAS 1275853-51-4) is a chemical compound with the molecular formula C13H15BrN2S and a molecular weight of 311.24 g/mol. IUPAC name: 4-(3-bromophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine. InChIKey: WSNSLNIKFLACBJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2S |
|---|---|
| Molecular weight | 311.24 g/mol |
| IUPAC name | 4-(3-bromophenyl)-N-(2-methylpropyl)-1,3-thiazol-2-amine |
| InChIKey | WSNSLNIKFLACBJ-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1=NC(=CS1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)