CAS 1276018-05-3 appears in our catalog under these names: cis-Hydroxy Perhexiline-d11 (Mixture of Diastereomers), >95% (HPLC), cis-Hydroxy perhexiline-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-[2-piperidin-2-yl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethyl]cyclohexan-1-ol (CAS 1276018-05-3) is a chemical compound with the molecular formula C19H35NO and a molecular weight of 304.6 g/mol. IUPAC name: 4-[2-piperidin-2-yl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethyl]cyclohexan-1-ol. InChIKey: DZFRYNPJLZCKSC-PDPLMXNGSA-N.
| Molecular formula | C19H35NO |
|---|---|
| Molecular weight | 304.6 g/mol |
| IUPAC name | 4-[2-piperidin-2-yl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethyl]cyclohexan-1-ol |
| InChIKey | DZFRYNPJLZCKSC-PDPLMXNGSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C(CC2CCCCN2)C3CCC(CC3)O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)