Products 1276021-10-3
CAS 1276021-10-3 is the registry number for Cavutilide (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide;hydrochloride (CAS 1276021-10-3) is a chemical compound with the molecular formula C22H27ClFN3O3 and a molecular weight of 435.9 g/mol. IUPAC name: N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide;hydrochloride. InChIKey: BAIPQSYTPAIAHY-UHFFFAOYSA-N.
| Molecular formula | C22H27ClFN3O3 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide;hydrochloride |
| InChIKey | BAIPQSYTPAIAHY-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)CC(C2=CC=C(C=C2)F)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)