Products 1276023-43-8
CAS 1276023-43-8 is the registry number for 3-Chloro-4'-vinyl-1,1'-biphenyl, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-chloro-3-(4-ethenylphenyl)benzene (CAS 1276023-43-8) is a chemical compound with the molecular formula C14H11Cl and a molecular weight of 214.69 g/mol. IUPAC name: 1-chloro-3-(4-ethenylphenyl)benzene. InChIKey: SLBHDBUVBUJKOQ-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 1-chloro-3-(4-ethenylphenyl)benzene |
| InChIKey | SLBHDBUVBUJKOQ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)