CAS 36375-77-6 is the registry number for 9-(Chloromethyl)-9H-fluorene. Offered by: TRC. Available pack sizes: 1g.
9-(chloromethyl)-9H-fluorene (CAS 36375-77-6) is a chemical compound with the molecular formula C14H11Cl and a molecular weight of 214.69 g/mol. IUPAC name: 9-(chloromethyl)-9H-fluorene. InChIKey: KWRQHOKCZDPPQT-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 9-(chloromethyl)-9H-fluorene |
| InChIKey | KWRQHOKCZDPPQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CCl |
Computed by PubChem (NCBI)