Products 1276197-32-0
CAS 1276197-32-0 appears in our catalog under these names: Pentamidine-d4 2HCl (pentane-1,1,5,5-d4), 99 atom % D, min 98% Chemical Purity, Pentamidine–d4 dihydrochloride, Pentamidine-d4 (dihydrochloride), 98.49%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 1 mg, 5 mg.
4-[5-(4-carbamimidoylphenoxy)-1,1,5,5-tetradeuteriopentoxy]benzenecarboximidamide;dihydrochloride (CAS 1276197-32-0) is a chemical compound with the molecular formula C19H26Cl2N4O2 and a molecular weight of 417.4 g/mol. IUPAC name: 4-[5-(4-carbamimidoylphenoxy)-1,1,5,5-tetradeuteriopentoxy]benzenecarboximidamide;dihydrochloride. InChIKey: HWURPQUPKQFGJI-XQZXWLSLSA-N.
| Molecular formula | C19H26Cl2N4O2 |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | 4-[5-(4-carbamimidoylphenoxy)-1,1,5,5-tetradeuteriopentoxy]benzenecarboximidamide;dihydrochloride |
| InChIKey | HWURPQUPKQFGJI-XQZXWLSLSA-N |
| SMILES | [2H]C([2H])(CCCC([2H])([2H])OC1=CC=C(C=C1)C(=N)N)OC2=CC=C(C=C2)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)