Products 1276197-37-5
CAS 1276197-37-5 is the registry number for 2-Chloroaniline-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g.
2-chloro-N,N,3,4,5,6-hexadeuterioaniline (CAS 1276197-37-5) is a chemical compound with the molecular formula C6H6ClN and a molecular weight of 133.61 g/mol. IUPAC name: 2-chloro-N,N,3,4,5,6-hexadeuterioaniline. InChIKey: AKCRQHGQIJBRMN-UDDMDDBKSA-N.
| Molecular formula | C6H6ClN |
|---|---|
| Molecular weight | 133.61 g/mol |
| IUPAC name | 2-chloro-N,N,3,4,5,6-hexadeuterioaniline |
| InChIKey | AKCRQHGQIJBRMN-UDDMDDBKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N([2H])[2H])Cl)[2H])[2H] |
Computed by PubChem (NCBI)