Products 1276197-44-4
CAS 1276197-44-4 appears in our catalog under these names: (±)-Carazolol-d7 HCl (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Carazolol-d7 (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5mg, 1mg.
1-(9H-carbazol-4-yloxy)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)propan-2-ol;hydrochloride (CAS 1276197-44-4) is a chemical compound with the molecular formula C18H23ClN2O2 and a molecular weight of 341.9 g/mol. IUPAC name: 1-(9H-carbazol-4-yloxy)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: DXYNUICMBSWZMR-ODLOEXKQSA-N.
| Molecular formula | C18H23ClN2O2 |
|---|---|
| Molecular weight | 341.9 g/mol |
| IUPAC name | 1-(9H-carbazol-4-yloxy)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | DXYNUICMBSWZMR-ODLOEXKQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC2=C1C3=CC=CC=C3N2)O.Cl |
Computed by PubChem (NCBI)