CAS 127633-36-7 appears in our catalog under these names: Fmoc-tyr(po3me2)-oh, 95%, Fmoc–Tyr(PO₃Me₂)–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg.
(2S)-3-(4-dimethoxyphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 127633-36-7) is a chemical compound with the molecular formula C26H26NO8P and a molecular weight of 511.5 g/mol. IUPAC name: (2S)-3-(4-dimethoxyphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZQHCDMSMVMNCER-DEOSSOPVSA-N.
| Molecular formula | C26H26NO8P |
|---|---|
| Molecular weight | 511.5 g/mol |
| IUPAC name | (2S)-3-(4-dimethoxyphosphoryloxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZQHCDMSMVMNCER-DEOSSOPVSA-N |
| SMILES | COP(=O)(OC)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)