CAS 1276539-32-2 appears in our catalog under these names: 9-(2,6-Dimethylphenyl)-10-methylacridinium perchlorate, 95%, 9–(2,6–Dimethylphenyl)–10–methylacridinium Perchlorate, 9-(2,6-Dimethylphenyl)-10-methylacridin-10-ium perchlorate, 97%, 97%, 9-(2,6-Dimethylphenyl)-10-methylacridinium Perchlorate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg, 100mg, 5g.
9-(2,6-dimethylphenyl)-10-methylacridin-10-ium perchlorate (CAS 1276539-32-2) is a chemical compound with the molecular formula C22H20ClNO4 and a molecular weight of 397.8 g/mol. IUPAC name: 9-(2,6-dimethylphenyl)-10-methylacridin-10-ium perchlorate. InChIKey: AUILEGHJOMNNKY-UHFFFAOYSA-M.
| Molecular formula | C22H20ClNO4 |
|---|---|
| Molecular weight | 397.8 g/mol |
| IUPAC name | 9-(2,6-dimethylphenyl)-10-methylacridin-10-ium perchlorate |
| InChIKey | AUILEGHJOMNNKY-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)