CAS 1276541-94-6 appears in our catalog under these names: 5-(Trifluoromethyl)-1h-pyrazole-3-carboxamide, 95%, 5–(Trifluoromethyl)pyrazole–3–carboxamide, 5-(Trifluoromethyl)pyrazole-3-carboxamide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (CAS 1276541-94-6) is a chemical compound with the molecular formula C5H4F3N3O and a molecular weight of 179.10 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrazole-3-carboxamide. InChIKey: ZGCQBYSIGOKBNS-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O |
|---|---|
| Molecular weight | 179.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| InChIKey | ZGCQBYSIGOKBNS-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)