CAS 1276584-06-5 is the registry number for 5-Bromo-2-iodo-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-iodo-N,N-dimethylbenzamide (CAS 1276584-06-5) is a chemical compound with the molecular formula C9H9BrINO and a molecular weight of 353.98 g/mol. IUPAC name: 5-bromo-2-iodo-N,N-dimethylbenzamide. InChIKey: UEOLNKHZTHLOBB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrINO |
|---|---|
| Molecular weight | 353.98 g/mol |
| IUPAC name | 5-bromo-2-iodo-N,N-dimethylbenzamide |
| InChIKey | UEOLNKHZTHLOBB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)Br)I |
Computed by PubChem (NCBI)