CAS 1276647-94-9 appears in our catalog under these names: Sodium 3,4-dimethylbenzene-1-sulfinate, 95%, Sodium 3,4-dimethylbenzene-1-sulfinate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Sodium 3,4-dimethylbenzenesulfinate (CAS 1276647-94-9) is a chemical compound with the molecular formula C8H9NaO2S and a molecular weight of 192.21 g/mol. IUPAC name: sodium 3,4-dimethylbenzenesulfinate. InChIKey: ZNWJXJSZYBZSMD-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO2S |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | sodium 3,4-dimethylbenzenesulfinate |
| InChIKey | ZNWJXJSZYBZSMD-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1)S(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)