CAS 1276664-65-3 is the registry number for GSK8470. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3aS,6aR)-5-[(E)-oct-4-en-4-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine (CAS 1276664-65-3) is a chemical compound with the molecular formula C28H35N and a molecular weight of 385.6 g/mol. IUPAC name: (3aS,6aR)-5-[(E)-oct-4-en-4-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine. InChIKey: WRZLRWJDJPFDGG-KTNSFKJWSA-N.
| Molecular formula | C28H35N |
|---|---|
| Molecular weight | 385.6 g/mol |
| IUPAC name | (3aS,6aR)-5-[(E)-oct-4-en-4-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
| InChIKey | WRZLRWJDJPFDGG-KTNSFKJWSA-N |
| SMILES | CCC/C=C(\CCC)/C1=C([C@@]2(CCC[C@@H]2C1)NC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)